C18H31N3O2 — CID 29256292
2-(cyclohexen-1-yl)-1-[(3R,4R)-3-hydroxy-4-(4-methylpiperazin-1-yl)piperidin-1-yl]ethanone (PubChem CID 29256292) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[(3R,4R)-3-hydroxy-4-(4-methylpiperazin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[(3R,4R)-3-hydroxy-4-(4-methylpiperazin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 29256292 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[(3R,4R)-3-hydroxy-4-(4-methylpiperazin-1-yl)piperidin-1-yl]ethanone |
| SMILES | CN1CCN([C@@H]2CCN(C(=O)CC3=CCCCC3)C[C@H]2O)CC1 |
| InChI | InChI=1S/C18H31N3O2/c1-19-9-11-20(12-10-19)16-7-8-21(14-17(16)22)18(23)13-15-5-3-2-4-6-15/h5,16-17,22H,2-4,6-14H2,1H3/t16-,17-/m1/s1 |
| InChIKey | KGRQNRHMRKSJSX-IAGOWNOFSA-N |
| XLogP | 1.09 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|