C19H27N3 — CID 29256573
(3S)-3-[4-(4-methylphenyl)-1H-pyrazol-5-yl]-1-(2-methylpropyl)piperidine (PubChem CID 29256573) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is (3S)-3-[4-(4-methylphenyl)-1H-pyrazol-5-yl]-1-(2-methylpropyl)piperidine.
| Compound Name | (3S)-3-[4-(4-methylphenyl)-1H-pyrazol-5-yl]-1-(2-methylpropyl)piperidine |
|---|---|
| PubChem CID | 29256573 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | (3S)-3-[4-(4-methylphenyl)-1H-pyrazol-5-yl]-1-(2-methylpropyl)piperidine |
| SMILES | Cc1ccc(-c2cn[nH]c2[C@H]2CCCN(CC(C)C)C2)cc1 |
| InChI | InChI=1S/C19H27N3/c1-14(2)12-22-10-4-5-17(13-22)19-18(11-20-21-19)16-8-6-15(3)7-9-16/h6-9,11,14,17H,4-5,10,12-13H2,1-3H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | VGXUDYQFQLLKJY-KRWDZBQOSA-N |
| XLogP | 4.22 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |