C28H22N2O4 — CID 2925801
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenoxyphenyl)benzamide (PubChem CID 2925801) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2925801 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-phenoxyphenyl)benzamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccc(N2C(=O)C3C4C=CC(C4)C3C2=O)c1 |
| InChI | InChI=1S/C28H22N2O4/c31-26(29-20-11-13-23(14-12-20)34-22-7-2-1-3-8-22)19-5-4-6-21(16-19)30-27(32)24-17-9-10-18(15-17)25(24)28(30)33/h1-14,16-18,24-25H,15H2,(H,29,31) |
| InChIKey | JRCQKDQMPZHPBB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|