C19H21ClN2O3 — CID 2925807
N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide (PubChem CID 2925807) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide |
|---|---|
| PubChem CID | 2925807 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CCN1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C19H21ClN2O3/c1-10-2-5-13(20)9-14(10)21-15(23)6-7-22-18(24)16-11-3-4-12(8-11)17(16)19(22)25/h2,5,9,11-12,16-17H,3-4,6-8H2,1H3,(H,21,23) |
| InChIKey | PHOXYRXIMXQVMB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|