About 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine
5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine (PubChem CID 29258824) has the molecular formula C17H15F3N4
and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine.
Molecular Properties
| Compound Name | 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine |
| PubChem CID | 29258824 |
| Molecular Formula | C17H15F3N4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine |
| SMILES | FC(F)(F)CCCn1ccc(-c2cccc(-c3cncnc3)c2)n1 |
| InChI | InChI=1S/C17H15F3N4/c18-17(19,20)6-2-7-24-8-5-16(23-24)14-4-1-3-13(9-14)15-10-21-12-22-11-15/h1,3-5,8-12H,2,6-7H2 |
| InChIKey | AKWFUJHELLXUMH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine?
The IUPAC name of 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine (CID 29258824) is 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine.
What is the SMILES notation for 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine?
The canonical SMILES for 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine is FC(F)(F)CCCn1ccc(-c2cccc(-c3cncnc3)c2)n1.
What is the InChIKey of 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine?
The InChIKey is AKWFUJHELLXUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4/c18-17(19,20)6-2-7-24-8-5-16(23-24)14-4-1-3-13(9-14)15-10-21-12-22-11-15/h1,3-5,8-12H,2,6-7H2.
What are the key properties of 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine?
5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine has a molecular weight of 332.33 g/mol, XLogP of 4.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[1-(4,4,4-trifluorobutyl)pyrazol-3-yl]phenyl]pyrimidine is sourced from PubChem (CID 29258824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).