C26H27N5O2 — CID 29258956
2-methoxy-N-[2-[1-(quinolin-5-ylmethyl)piperidin-4-yl]pyrazol-3-yl]benzamide (PubChem CID 29258956) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-methoxy-N-[2-[1-(quinolin-5-ylmethyl)piperidin-4-yl]pyrazol-3-yl]benzamide.
| Compound Name | 2-methoxy-N-[2-[1-(quinolin-5-ylmethyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 29258956 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-methoxy-N-[2-[1-(quinolin-5-ylmethyl)piperidin-4-yl]pyrazol-3-yl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccnn1C1CCN(Cc2cccc3ncccc23)CC1 |
| InChI | InChI=1S/C26H27N5O2/c1-33-24-10-3-2-7-22(24)26(32)29-25-11-15-28-31(25)20-12-16-30(17-13-20)18-19-6-4-9-23-21(19)8-5-14-27-23/h2-11,14-15,20H,12-13,16-18H2,1H3,(H,29,32) |
| InChIKey | MAPUEDGGGKNWRI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |