C21H24F3NO2 — CID 29259096
4-[[4-(hydroxymethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenol (PubChem CID 29259096) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-[[4-(hydroxymethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenol.
| Compound Name | 4-[[4-(hydroxymethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 29259096 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[[4-(hydroxymethyl)-4-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]methyl]phenol |
| SMILES | OCC1(Cc2ccccc2C(F)(F)F)CCN(Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C21H24F3NO2/c22-21(23,24)19-4-2-1-3-17(19)13-20(15-26)9-11-25(12-10-20)14-16-5-7-18(27)8-6-16/h1-8,26-27H,9-15H2 |
| InChIKey | QJMMCXYQOJAKSP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |