About N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide
N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide (PubChem CID 2925950) has the molecular formula C18H19ClN2O3
and a molecular weight of 346.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide |
| PubChem CID | 2925950 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2C3CCC(C3)C2C1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3/c19-12-3-1-2-4-13(12)20-14(22)7-8-21-17(23)15-10-5-6-11(9-10)16(15)18(21)24/h1-4,10-11,15-16H,5-9H2,(H,20,22) |
| InChIKey | WSWWFYFEDXGTDZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide?
The IUPAC name of N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide (CID 2925950) is N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide.
What is the SMILES notation for N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide?
The canonical SMILES for N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide is O=C(CCN1C(=O)C2C3CCC(C3)C2C1=O)Nc1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide?
The InChIKey is WSWWFYFEDXGTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O3/c19-12-3-1-2-4-13(12)20-14(22)7-8-21-17(23)15-10-5-6-11(9-10)16(15)18(21)24/h1-4,10-11,15-16H,5-9H2,(H,20,22).
What are the key properties of N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide?
N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide has a molecular weight of 346.81 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)propanamide is sourced from PubChem (CID 2925950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).