C20H23Cl2NO — CID 29261
2-[(3-chloro-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)oxy]ethyl-dimethylazanium chloride (PubChem CID 29261) has the molecular formula C20H23Cl2NO and a molecular weight of 364.32 g/mol. Its IUPAC name is 2-[(3-chloro-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)oxy]ethyl-dimethylazanium chloride.
| Compound Name | 2-[(3-chloro-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)oxy]ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 29261 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-[(3-chloro-1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaenyl)oxy]ethyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCOC12CCC(c3ccccc31)c1cccc(Cl)c12.[Cl-] |
| InChI | InChI=1S/C20H22ClNO.ClH/c1-22(2)12-13-23-20-11-10-14(15-6-3-4-8-17(15)20)16-7-5-9-18(21)19(16)20;/h3-9,14H,10-13H2,1-2H3;1H |
| InChIKey | VPDBLBIQUCJSHI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |