C27H32N2O7 — CID 2926217
2-[4-[3-[(4-butoxyphenyl)-hydroxymethylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide (PubChem CID 2926217) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[4-[3-[(4-butoxyphenyl)-hydroxymethylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[3-[(4-butoxyphenyl)-hydroxymethylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 2926217 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 2-[4-[3-[(4-butoxyphenyl)-hydroxymethylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide |
| SMILES | CCCCOc1ccc(C(O)=C2C(=O)C(=O)N(CCCOC)C2c2ccc(OCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O7/c1-3-4-16-35-20-12-8-19(9-13-20)25(31)23-24(29(14-5-15-34-2)27(33)26(23)32)18-6-10-21(11-7-18)36-17-22(28)30/h6-13,24,31H,3-5,14-17H2,1-2H3,(H2,28,30) |
| InChIKey | BFDPRTWATUMNON-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|