C15H19N3O2S — CID 29268617
N-(4-carbamothioylphenyl)-4-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 29268617) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(4-carbamothioylphenyl)-4-(2-oxopyrrolidin-1-yl)butanamide.
| Compound Name | N-(4-carbamothioylphenyl)-4-(2-oxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 29268617 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(4-carbamothioylphenyl)-4-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | NC(=S)c1ccc(NC(=O)CCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c16-15(21)11-5-7-12(8-6-11)17-13(19)3-1-9-18-10-2-4-14(18)20/h5-8H,1-4,9-10H2,(H2,16,21)(H,17,19) |
| InChIKey | RFTXETGFQVOILF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|