About 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid
6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid (PubChem CID 29268767) has the molecular formula C13H8ClN3O2S
and a molecular weight of 305.75 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid |
| PubChem CID | 29268767 |
| Molecular Formula | C13H8ClN3O2S |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C13H8ClN3O2S/c14-8-5-7(12(18)19)6-15-11(8)17-13-16-9-3-1-2-4-10(9)20-13/h1-6H,(H,18,19)(H,15,16,17) |
| InChIKey | PDEFXDFJSORNAT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid?
The IUPAC name of 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid (CID 29268767) is 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid.
What is the SMILES notation for 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid?
The canonical SMILES for 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid is O=C(O)c1cnc(Nc2nc3ccccc3s2)c(Cl)c1.
What is the InChIKey of 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid?
The InChIKey is PDEFXDFJSORNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN3O2S/c14-8-5-7(12(18)19)6-15-11(8)17-13-16-9-3-1-2-4-10(9)20-13/h1-6H,(H,18,19)(H,15,16,17).
What are the key properties of 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid?
6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid has a molecular weight of 305.75 g/mol, XLogP of 3.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzothiazol-2-ylamino)-5-chloropyridine-3-carboxylic acid is sourced from PubChem (CID 29268767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).