About spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride
spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride (PubChem CID 2927039) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride.
Molecular Properties
| Compound Name | spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride |
| PubChem CID | 2927039 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C11H13NO2.ClH/c12-8-3-4-9-10(7-8)14-11(13-9)5-1-2-6-11;/h3-4,7H,1-2,5-6,12H2;1H |
| InChIKey | UMLSTNVOWHQQSB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride?
The IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride (CID 2927039) is spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride.
What is the SMILES notation for spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride?
The canonical SMILES for spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride is Cl.Nc1ccc2c(c1)OC1(CCCC1)O2.
What is the InChIKey of spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride?
The InChIKey is UMLSTNVOWHQQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c12-8-3-4-9-10(7-8)14-11(13-9)5-1-2-6-11;/h3-4,7H,1-2,5-6,12H2;1H.
What are the key properties of spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride?
spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-amine;hydrochloride is sourced from PubChem (CID 2927039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).