About bis(2-benzamidoethyl) furan-2,5-dicarboxylate
bis(2-benzamidoethyl) furan-2,5-dicarboxylate (PubChem CID 2927045) has the molecular formula C24H22N2O7
and a molecular weight of 450.45 g/mol. Its IUPAC name is bis(2-benzamidoethyl) furan-2,5-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-benzamidoethyl) furan-2,5-dicarboxylate |
| PubChem CID | 2927045 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | bis(2-benzamidoethyl) furan-2,5-dicarboxylate |
| SMILES | O=C(NCCOC(=O)c1ccc(C(=O)OCCNC(=O)c2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O7/c27-21(17-7-3-1-4-8-17)25-13-15-31-23(29)19-11-12-20(33-19)24(30)32-16-14-26-22(28)18-9-5-2-6-10-18/h1-12H,13-16H2,(H,25,27)(H,26,28) |
| InChIKey | ZMGOCXAFYXMQEW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-benzamidoethyl) furan-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-benzamidoethyl) furan-2,5-dicarboxylate?
The IUPAC name of bis(2-benzamidoethyl) furan-2,5-dicarboxylate (CID 2927045) is bis(2-benzamidoethyl) furan-2,5-dicarboxylate.
What is the SMILES notation for bis(2-benzamidoethyl) furan-2,5-dicarboxylate?
The canonical SMILES for bis(2-benzamidoethyl) furan-2,5-dicarboxylate is O=C(NCCOC(=O)c1ccc(C(=O)OCCNC(=O)c2ccccc2)o1)c1ccccc1.
What is the InChIKey of bis(2-benzamidoethyl) furan-2,5-dicarboxylate?
The InChIKey is ZMGOCXAFYXMQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O7/c27-21(17-7-3-1-4-8-17)25-13-15-31-23(29)19-11-12-20(33-19)24(30)32-16-14-26-22(28)18-9-5-2-6-10-18/h1-12H,13-16H2,(H,25,27)(H,26,28).
What are the key properties of bis(2-benzamidoethyl) furan-2,5-dicarboxylate?
bis(2-benzamidoethyl) furan-2,5-dicarboxylate has a molecular weight of 450.45 g/mol, XLogP of 2.45, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-benzamidoethyl) furan-2,5-dicarboxylate is sourced from PubChem (CID 2927045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).