About 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid
5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid (PubChem CID 29271509) has the molecular formula C14H7Cl2NO3S
and a molecular weight of 340.19 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 29271509 |
| Molecular Formula | C14H7Cl2NO3S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2cccs2)oc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H7Cl2NO3S/c15-8-4-7(5-9(16)6-8)12-11(14(18)19)17-13(20-12)10-2-1-3-21-10/h1-6H,(H,18,19) |
| InChIKey | JXDQPSXUEXZCCU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid (CID 29271509) is 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid is O=C(O)c1nc(-c2cccs2)oc1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid?
The InChIKey is JXDQPSXUEXZCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl2NO3S/c15-8-4-7(5-9(16)6-8)12-11(14(18)19)17-13(20-12)10-2-1-3-21-10/h1-6H,(H,18,19).
What are the key properties of 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid?
5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid has a molecular weight of 340.19 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-2-thiophen-2-yl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 29271509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).