About 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole
2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole (PubChem CID 2927162) has the molecular formula C16H11N3O2S
and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole |
| PubChem CID | 2927162 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2noc(CSc3nc4ccccc4o3)n2)cc1 |
| InChI | InChI=1S/C16H11N3O2S/c1-2-6-11(7-3-1)15-18-14(21-19-15)10-22-16-17-12-8-4-5-9-13(12)20-16/h1-9H,10H2 |
| InChIKey | VZXANSUMSNOENL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole?
The IUPAC name of 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole (CID 2927162) is 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole.
What is the SMILES notation for 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole?
The canonical SMILES for 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole is c1ccc(-c2noc(CSc3nc4ccccc4o3)n2)cc1.
What is the InChIKey of 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole?
The InChIKey is VZXANSUMSNOENL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2S/c1-2-6-11(7-3-1)15-18-14(21-19-15)10-22-16-17-12-8-4-5-9-13(12)20-16/h1-9H,10H2.
What are the key properties of 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole?
2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole has a molecular weight of 309.35 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-1,3-benzoxazole is sourced from PubChem (CID 2927162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).