C17H14N2OS2 — CID 2927181
4,5-dimethyl-13-phenyl-3,10-dithia-1,8-diazatricyclo[7.4.0.02,6]trideca-2(6),4,8,11-tetraen-7-one (PubChem CID 2927181) has the molecular formula C17H14N2OS2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 4,5-dimethyl-13-phenyl-3,10-dithia-1,8-diazatricyclo[7.4.0.02,6]trideca-2(6),4,8,11-tetraen-7-one.
| Compound Name | 4,5-dimethyl-13-phenyl-3,10-dithia-1,8-diazatricyclo[7.4.0.02,6]trideca-2(6),4,8,11-tetraen-7-one |
|---|---|
| PubChem CID | 2927181 |
| Molecular Formula | C17H14N2OS2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4,5-dimethyl-13-phenyl-3,10-dithia-1,8-diazatricyclo[7.4.0.02,6]trideca-2(6),4,8,11-tetraen-7-one |
| SMILES | Cc1sc2c(c1C)c(=O)nc1n2C(c2ccccc2)C=CS1 |
| InChI | InChI=1S/C17H14N2OS2/c1-10-11(2)22-16-14(10)15(20)18-17-19(16)13(8-9-21-17)12-6-4-3-5-7-12/h3-9,13H,1-2H3 |
| InChIKey | NZBLEWUCLAJCPX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |