C15H17FN2O3S — CID 2927341
5-(diethyl-lambda4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2927341) has the molecular formula C15H17FN2O3S and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-(diethyl-lambda4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(diethyl-lambda4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2927341 |
| Molecular Formula | C15H17FN2O3S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-(diethyl-lambda4-sulfanylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCS(CC)=C1C(=O)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H17FN2O3S/c1-3-22(4-2)12-13(19)17-15(21)18(14(12)20)9-10-5-7-11(16)8-6-10/h5-8H,3-4,9H2,1-2H3,(H,17,19,21) |
| InChIKey | HLLPBEFSCHQKIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|