C13H18F3N — CID 29276237
(1S)-2,2,2-trifluoro-1-(2,3,4,5,6-pentamethylphenyl)ethanamine (PubChem CID 29276237) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(2,3,4,5,6-pentamethylphenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(2,3,4,5,6-pentamethylphenyl)ethanamine |
|---|---|
| PubChem CID | 29276237 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(2,3,4,5,6-pentamethylphenyl)ethanamine |
| SMILES | Cc1c(C)c(C)c([C@H](N)C(F)(F)F)c(C)c1C |
| InChI | InChI=1S/C13H18F3N/c1-6-7(2)9(4)11(10(5)8(6)3)12(17)13(14,15)16/h12H,17H2,1-5H3/t12-/m0/s1 |
| InChIKey | UNJGHLGEKVGOMM-LBPRGKRZSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |