C13H16N2O2 — CID 29278022
(Z)-2-acetamido-N,N-dimethyl-3-phenylprop-2-enamide (PubChem CID 29278022) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (Z)-2-acetamido-N,N-dimethyl-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-acetamido-N,N-dimethyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 29278022 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (Z)-2-acetamido-N,N-dimethyl-3-phenylprop-2-enamide |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)N(C)C |
| InChI | InChI=1S/C13H16N2O2/c1-10(16)14-12(13(17)15(2)3)9-11-7-5-4-6-8-11/h4-9H,1-3H3,(H,14,16)/b12-9- |
| InChIKey | TYGFKAVVUFIJEG-XFXZXTDPSA-N |
| XLogP | 1.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|