C17H17N3S — CID 2927919
1,2-diphenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione (PubChem CID 2927919) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1,2-diphenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione.
| Compound Name | 1,2-diphenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 2927919 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1,2-diphenyl-1,5,6,7-tetrahydropyrazolo[1,2-a][1,2,4]triazole-3-thione |
| SMILES | S=C1N(c2ccccc2)C(c2ccccc2)N2CCCN12 |
| InChI | InChI=1S/C17H17N3S/c21-17-19-13-7-12-18(19)16(14-8-3-1-4-9-14)20(17)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2 |
| InChIKey | UDEODCYGUXPGKW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|