About 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide
6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide (PubChem CID 2928063) has the molecular formula C11H17N3O3
and a molecular weight of 239.27 g/mol. Its IUPAC name is 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
| PubChem CID | 2928063 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
| SMILES | CC12CN([N+](=O)[O-])C3(C(N)=O)CC1CCC23C |
| InChI | InChI=1S/C11H17N3O3/c1-9-6-13(14(16)17)11(8(12)15)5-7(9)3-4-10(9,11)2/h7H,3-6H2,1-2H3,(H2,12,15) |
| InChIKey | UWJNPVCWVBHAMS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide?
The IUPAC name of 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide (CID 2928063) is 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide.
What is the SMILES notation for 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide?
The canonical SMILES for 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide is CC12CN([N+](=O)[O-])C3(C(N)=O)CC1CCC23C.
What is the InChIKey of 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide?
The InChIKey is UWJNPVCWVBHAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-9-6-13(14(16)17)11(8(12)15)5-7(9)3-4-10(9,11)2/h7H,3-6H2,1-2H3,(H2,12,15).
What are the key properties of 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide?
6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide has a molecular weight of 239.27 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide is sourced from PubChem (CID 2928063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).