C18H14N2O3S — CID 2928239
3-benzyl-8-methoxypyrimido[2,1-b][1,3]benzothiazole-2,4-dione (PubChem CID 2928239) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-benzyl-8-methoxypyrimido[2,1-b][1,3]benzothiazole-2,4-dione.
| Compound Name | 3-benzyl-8-methoxypyrimido[2,1-b][1,3]benzothiazole-2,4-dione |
|---|---|
| PubChem CID | 2928239 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-benzyl-8-methoxypyrimido[2,1-b][1,3]benzothiazole-2,4-dione |
| SMILES | COc1ccc2c(c1)SC1=NC(=O)C(Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C18H14N2O3S/c1-23-12-7-8-14-15(10-12)24-18-19-16(21)13(17(22)20(14)18)9-11-5-3-2-4-6-11/h2-8,10,13H,9H2,1H3 |
| InChIKey | TZLQDAXJSITRIB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|