About 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine
4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine (PubChem CID 2928291) has the molecular formula C19H19N3O3
and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine |
| PubChem CID | 2928291 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(N2CCOCC2)c(C2=NCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H19N3O3/c23-22(24)15-5-6-18(21-9-11-25-12-10-21)17(13-15)19-16-4-2-1-3-14(16)7-8-20-19/h1-6,13H,7-12H2 |
| InChIKey | QPUZNJHOYTZJAH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine?
The IUPAC name of 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine (CID 2928291) is 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine.
What is the SMILES notation for 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine?
The canonical SMILES for 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine is O=[N+]([O-])c1ccc(N2CCOCC2)c(C2=NCCc3ccccc32)c1.
What is the InChIKey of 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine?
The InChIKey is QPUZNJHOYTZJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3/c23-22(24)15-5-6-18(21-9-11-25-12-10-21)17(13-15)19-16-4-2-1-3-14(16)7-8-20-19/h1-6,13H,7-12H2.
What are the key properties of 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine?
4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine has a molecular weight of 337.38 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dihydroisoquinolin-1-yl)-4-nitrophenyl]morpholine is sourced from PubChem (CID 2928291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).