C17H17N3O3S — CID 2928548
3-methyl-2-(4-nitrophenyl)-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2928548) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-methyl-2-(4-nitrophenyl)-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-(4-nitrophenyl)-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2928548 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-methyl-2-(4-nitrophenyl)-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CN1C(=O)c2c(sc3c2CCCC3)NC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-19-15(10-6-8-11(9-7-10)20(22)23)18-16-14(17(19)21)12-4-2-3-5-13(12)24-16/h6-9,15,18H,2-5H2,1H3 |
| InChIKey | GICPPULCPKRWOB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|