About 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone
1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 2928826) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| PubChem CID | 2928826 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(C)cc2C(c2ccccc2)CC1C |
| InChI | InChI=1S/C19H21NO/c1-13-9-10-19-18(11-13)17(16-7-5-4-6-8-16)12-14(2)20(19)15(3)21/h4-11,14,17H,12H2,1-3H3 |
| InChIKey | OCNONKLTLPWSNP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone?
The IUPAC name of 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (CID 2928826) is 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
What is the SMILES notation for 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone?
The canonical SMILES for 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone is CC(=O)N1c2ccc(C)cc2C(c2ccccc2)CC1C.
What is the InChIKey of 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone?
The InChIKey is OCNONKLTLPWSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO/c1-13-9-10-19-18(11-13)17(16-7-5-4-6-8-16)12-14(2)20(19)15(3)21/h4-11,14,17H,12H2,1-3H3.
What are the key properties of 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone?
1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone has a molecular weight of 279.38 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethyl-4-phenyl-3,4-dihydro-2H-quinolin-1-yl)ethanone is sourced from PubChem (CID 2928826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).