C16H22N2O2S — CID 29288915
N-(1-acetyl-2,3-dihydroindol-5-yl)-2-tert-butylsulfanylacetamide (PubChem CID 29288915) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-2-tert-butylsulfanylacetamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-tert-butylsulfanylacetamide |
|---|---|
| PubChem CID | 29288915 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-tert-butylsulfanylacetamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)CSC(C)(C)C)ccc21 |
| InChI | InChI=1S/C16H22N2O2S/c1-11(19)18-8-7-12-9-13(5-6-14(12)18)17-15(20)10-21-16(2,3)4/h5-6,9H,7-8,10H2,1-4H3,(H,17,20) |
| InChIKey | YEYDIQRBPPVTSQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |