About (4-fluorophenyl) N-methyl-N-phenylcarbamate
(4-fluorophenyl) N-methyl-N-phenylcarbamate (PubChem CID 2929031) has the molecular formula C14H12FNO2
and a molecular weight of 245.25 g/mol. Its IUPAC name is (4-fluorophenyl) N-methyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | (4-fluorophenyl) N-methyl-N-phenylcarbamate |
| PubChem CID | 2929031 |
| Molecular Formula | C14H12FNO2 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (4-fluorophenyl) N-methyl-N-phenylcarbamate |
| SMILES | CN(C(=O)Oc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C14H12FNO2/c1-16(12-5-3-2-4-6-12)14(17)18-13-9-7-11(15)8-10-13/h2-10H,1H3 |
| InChIKey | AVXCRZCQILZACV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-fluorophenyl) N-methyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) N-methyl-N-phenylcarbamate?
The IUPAC name of (4-fluorophenyl) N-methyl-N-phenylcarbamate (CID 2929031) is (4-fluorophenyl) N-methyl-N-phenylcarbamate.
What is the SMILES notation for (4-fluorophenyl) N-methyl-N-phenylcarbamate?
The canonical SMILES for (4-fluorophenyl) N-methyl-N-phenylcarbamate is CN(C(=O)Oc1ccc(F)cc1)c1ccccc1.
What is the InChIKey of (4-fluorophenyl) N-methyl-N-phenylcarbamate?
The InChIKey is AVXCRZCQILZACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO2/c1-16(12-5-3-2-4-6-12)14(17)18-13-9-7-11(15)8-10-13/h2-10H,1H3.
What are the key properties of (4-fluorophenyl) N-methyl-N-phenylcarbamate?
(4-fluorophenyl) N-methyl-N-phenylcarbamate has a molecular weight of 245.25 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) N-methyl-N-phenylcarbamate is sourced from PubChem (CID 2929031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).