C22H15F3N4O3 — CID 2929236
5-[[1-(2-methylphenyl)pyrazol-4-yl]methylidene]-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2929236) has the molecular formula C22H15F3N4O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is 5-[[1-(2-methylphenyl)pyrazol-4-yl]methylidene]-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-(2-methylphenyl)pyrazol-4-yl]methylidene]-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2929236 |
| Molecular Formula | C22H15F3N4O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 5-[[1-(2-methylphenyl)pyrazol-4-yl]methylidene]-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccccc1-n1cc(C=C2C(=O)NC(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cn1 |
| InChI | InChI=1S/C22H15F3N4O3/c1-13-5-2-3-8-18(13)28-12-14(11-26-28)9-17-19(30)27-21(32)29(20(17)31)16-7-4-6-15(10-16)22(23,24)25/h2-12H,1H3,(H,27,30,32) |
| InChIKey | BTHKYPWXDCXZMP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|