About 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline
2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 29293150) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
Molecular Properties
| Compound Name | 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| PubChem CID | 29293150 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Cc1noc(-c2ccc(C)c(N)c2)n1 |
| InChI | InChI=1S/C10H11N3O/c1-6-3-4-8(5-9(6)11)10-12-7(2)13-14-10/h3-5H,11H2,1-2H3 |
| InChIKey | BITFOTATQDBPRQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline?
The IUPAC name of 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (CID 29293150) is 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
What is the SMILES notation for 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline?
The canonical SMILES for 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline is Cc1noc(-c2ccc(C)c(N)c2)n1.
What is the InChIKey of 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline?
The InChIKey is BITFOTATQDBPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-6-3-4-8(5-9(6)11)10-12-7(2)13-14-10/h3-5H,11H2,1-2H3.
What are the key properties of 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline?
2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline has a molecular weight of 189.22 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)aniline is sourced from PubChem (CID 29293150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).