About (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine
(1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine (PubChem CID 29293740) has the molecular formula C16H18FNS
and a molecular weight of 275.39 g/mol. Its IUPAC name is (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine |
| PubChem CID | 29293740 |
| Molecular Formula | C16H18FNS |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine |
| SMILES | Cc1ccc(Sc2cccc(F)c2[C@@H](C)N)c(C)c1 |
| InChI | InChI=1S/C16H18FNS/c1-10-7-8-14(11(2)9-10)19-15-6-4-5-13(17)16(15)12(3)18/h4-9,12H,18H2,1-3H3/t12-/m1/s1 |
| InChIKey | JJIFLHQSTLBMKL-GFCCVEGCSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine?
The IUPAC name of (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine (CID 29293740) is (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine.
What is the SMILES notation for (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine?
The canonical SMILES for (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine is Cc1ccc(Sc2cccc(F)c2[C@@H](C)N)c(C)c1.
What is the InChIKey of (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine?
The InChIKey is JJIFLHQSTLBMKL-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H18FNS/c1-10-7-8-14(11(2)9-10)19-15-6-4-5-13(17)16(15)12(3)18/h4-9,12H,18H2,1-3H3/t12-/m1/s1.
What are the key properties of (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine?
(1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine has a molecular weight of 275.39 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[2-(2,4-dimethylphenyl)sulfanyl-6-fluorophenyl]ethanamine is sourced from PubChem (CID 29293740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).