C14H14ClNO2S — CID 2929513
3-butyl-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2929513) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is 3-butyl-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-butyl-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2929513 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-butyl-5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)SC(=Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H14ClNO2S/c1-2-3-8-16-13(17)12(19-14(16)18)9-10-4-6-11(15)7-5-10/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | DIHMPOSCUGPPRF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|