C16H16ClN3O2 — CID 2929559
1-(4-chlorophenyl)-3-(3,4,5-trimethylpyrazol-1-yl)pyrrolidine-2,5-dione (PubChem CID 2929559) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,4,5-trimethylpyrazol-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3-(3,4,5-trimethylpyrazol-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2929559 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4,5-trimethylpyrazol-1-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1nn(C2CC(=O)N(c3ccc(Cl)cc3)C2=O)c(C)c1C |
| InChI | InChI=1S/C16H16ClN3O2/c1-9-10(2)18-20(11(9)3)14-8-15(21)19(16(14)22)13-6-4-12(17)5-7-13/h4-7,14H,8H2,1-3H3 |
| InChIKey | SHKKPWNIJOZJTN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|