About N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide
N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide (PubChem CID 2930103) has the molecular formula C13H17FN2OS
and a molecular weight of 268.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide |
| PubChem CID | 2930103 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide |
| SMILES | CC1CN(C(=S)Nc2ccccc2F)CC(C)O1 |
| InChI | InChI=1S/C13H17FN2OS/c1-9-7-16(8-10(2)17-9)13(18)15-12-6-4-3-5-11(12)14/h3-6,9-10H,7-8H2,1-2H3,(H,15,18) |
| InChIKey | FPYFVTODDGKILI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide?
The IUPAC name of N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide (CID 2930103) is N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide.
What is the SMILES notation for N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide?
The canonical SMILES for N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide is CC1CN(C(=S)Nc2ccccc2F)CC(C)O1.
What is the InChIKey of N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide?
The InChIKey is FPYFVTODDGKILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2OS/c1-9-7-16(8-10(2)17-9)13(18)15-12-6-4-3-5-11(12)14/h3-6,9-10H,7-8H2,1-2H3,(H,15,18).
What are the key properties of N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide?
N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide has a molecular weight of 268.36 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2,6-dimethylmorpholine-4-carbothioamide is sourced from PubChem (CID 2930103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).