C24H24N2O5S — CID 2930226
N-(3-acetylphenyl)-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 2930226) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | N-(3-acetylphenyl)-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 2930226 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-(3-acetylphenyl)-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)N(c2ccc(Oc3ccccc3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H24N2O5S/c1-17(24(28)25-20-9-7-8-19(16-20)18(2)27)26(32(3,29)30)21-12-14-23(15-13-21)31-22-10-5-4-6-11-22/h4-17H,1-3H3,(H,25,28) |
| InChIKey | BWPUBQFIXKZWFJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |