C29H26N6O — CID 2930286
7-(furan-2-ylmethyl)-N-(3-imidazol-1-ylpropyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 2930286) has the molecular formula C29H26N6O and a molecular weight of 474.57 g/mol. Its IUPAC name is 7-(furan-2-ylmethyl)-N-(3-imidazol-1-ylpropyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-(furan-2-ylmethyl)-N-(3-imidazol-1-ylpropyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2930286 |
| Molecular Formula | C29H26N6O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 7-(furan-2-ylmethyl)-N-(3-imidazol-1-ylpropyl)-5,6-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(-c2c(-c3ccccc3)n(Cc3ccco3)c3ncnc(NCCCn4ccnc4)c23)cc1 |
| InChI | InChI=1S/C29H26N6O/c1-3-9-22(10-4-1)25-26-28(31-14-8-16-34-17-15-30-21-34)32-20-33-29(26)35(19-24-13-7-18-36-24)27(25)23-11-5-2-6-12-23/h1-7,9-13,15,17-18,20-21H,8,14,16,19H2,(H,31,32,33) |
| InChIKey | YQXZBFZHTWSYND-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|