C16H13ClFN3O3S2 — CID 2930388
3-(2-chloro-6-fluorophenyl)-5-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1,2-oxazole-4-carboxamide (PubChem CID 2930388) has the molecular formula C16H13ClFN3O3S2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 2930388 |
| Molecular Formula | C16H13ClFN3O3S2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-methyl-N-[(2-oxothiolan-3-yl)carbamothioyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NC(=S)NC1CCSC1=O |
| InChI | InChI=1S/C16H13ClFN3O3S2/c1-7-11(13(21-24-7)12-8(17)3-2-4-9(12)18)14(22)20-16(25)19-10-5-6-26-15(10)23/h2-4,10H,5-6H2,1H3,(H2,19,20,22,25) |
| InChIKey | CWQLNWPTDZFLGX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|