C24H32N2O5S2 — CID 2930398
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(2-cyclohexylsulfanylethyl)acetamide (PubChem CID 2930398) has the molecular formula C24H32N2O5S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(2-cyclohexylsulfanylethyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(2-cyclohexylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 2930398 |
| Molecular Formula | C24H32N2O5S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(2-cyclohexylsulfanylethyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)NCCSC2CCCCC2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H32N2O5S2/c1-30-19-13-14-23(31-2)22(17-19)26(33(28,29)21-11-7-4-8-12-21)18-24(27)25-15-16-32-20-9-5-3-6-10-20/h4,7-8,11-14,17,20H,3,5-6,9-10,15-16,18H2,1-2H3,(H,25,27) |
| InChIKey | ILTQSDGEIOPWMC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|