C23H19N3O6 — CID 2931160
2-N,5-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-2,5-dicarboxamide (PubChem CID 2931160) has the molecular formula C23H19N3O6 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-N,5-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 2931160 |
| Molecular Formula | C23H19N3O6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-N,5-N-bis(2,3-dihydro-1,4-benzodioxin-6-yl)pyridine-2,5-dicarboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(C(=O)Nc2ccc3c(c2)OCCO3)nc1 |
| InChI | InChI=1S/C23H19N3O6/c27-22(25-15-2-5-18-20(11-15)31-9-7-29-18)14-1-4-17(24-13-14)23(28)26-16-3-6-19-21(12-16)32-10-8-30-19/h1-6,11-13H,7-10H2,(H,25,27)(H,26,28) |
| InChIKey | ICCURSVWOJYHSQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |