C25H20N4O3S — CID 2931430
3-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2931430) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2931430 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(-c2nc(SC3CC(=O)N(c4ccc(Oc5ccccc5)cc4)C3=O)n[nH]2)cc1 |
| InChI | InChI=1S/C25H20N4O3S/c1-16-7-9-17(10-8-16)23-26-25(28-27-23)33-21-15-22(30)29(24(21)31)18-11-13-20(14-12-18)32-19-5-3-2-4-6-19/h2-14,21H,15H2,1H3,(H,26,27,28) |
| InChIKey | PQIJWTIPDDTKMH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|