C21H19BrN2O3 — CID 2931621
N-(4-bromophenyl)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzamide (PubChem CID 2931621) has the molecular formula C21H19BrN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzamide.
| Compound Name | N-(4-bromophenyl)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 2931621 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-(4-bromophenyl)-4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccc(N2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C21H19BrN2O3/c22-14-7-9-15(10-8-14)23-19(25)13-5-11-16(12-6-13)24-20(26)17-3-1-2-4-18(17)21(24)27/h5-12,17-18H,1-4H2,(H,23,25) |
| InChIKey | ZNQXZTWGLYOZBG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|