About N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide
N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide (PubChem CID 2931693) has the molecular formula C24H31N3O6
and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide |
| PubChem CID | 2931693 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCCN1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C24H31N3O6/c1-30-17-7-5-8-18(31-2)21(17)23(28)25-11-12-26-13-15-27(16-14-26)24(29)22-19(32-3)9-6-10-20(22)33-4/h5-10H,11-16H2,1-4H3,(H,25,28) |
| InChIKey | ISTZECZCSVJVBR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide?
The IUPAC name of N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide (CID 2931693) is N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide.
What is the SMILES notation for N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide?
The canonical SMILES for N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide is COc1cccc(OC)c1C(=O)NCCN1CCN(C(=O)c2c(OC)cccc2OC)CC1.
What is the InChIKey of N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide?
The InChIKey is ISTZECZCSVJVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O6/c1-30-17-7-5-8-18(31-2)21(17)23(28)25-11-12-26-13-15-27(16-14-26)24(29)22-19(32-3)9-6-10-20(22)33-4/h5-10H,11-16H2,1-4H3,(H,25,28).
What are the key properties of N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide?
N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide has a molecular weight of 457.53 g/mol, XLogP of 1.91, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]ethyl]-2,6-dimethoxybenzamide is sourced from PubChem (CID 2931693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).