About N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide
N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide (PubChem CID 2931908) has the molecular formula C12H16N2O3S
and a molecular weight of 268.34 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide |
| PubChem CID | 2931908 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccs1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C12H16N2O3S/c15-11(13-7-9-3-1-5-17-9)12(16)14-8-10-4-2-6-18-10/h2,4,6,9H,1,3,5,7-8H2,(H,13,15)(H,14,16) |
| InChIKey | JXALYTDSCMQQEM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide (CID 2931908) is N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide is O=C(NCc1cccs1)C(=O)NCC1CCCO1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide?
The InChIKey is JXALYTDSCMQQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S/c15-11(13-7-9-3-1-5-17-9)12(16)14-8-10-4-2-6-18-10/h2,4,6,9H,1,3,5,7-8H2,(H,13,15)(H,14,16).
What are the key properties of N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide?
N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide has a molecular weight of 268.34 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-N'-(thiophen-2-ylmethyl)oxamide is sourced from PubChem (CID 2931908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).