C17H24N2O3S — CID 2931939
[1-(benzenesulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 2931939) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 2931939 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2ccccc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3S/c20-17(18-11-5-2-6-12-18)15-8-7-13-19(14-15)23(21,22)16-9-3-1-4-10-16/h1,3-4,9-10,15H,2,5-8,11-14H2 |
| InChIKey | MJYIOVYQWOCDQZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |