C21H27F3N2O5 — CID 2932263
oxalic acid;piperidin-1-yl-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methanone (PubChem CID 2932263) has the molecular formula C21H27F3N2O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is oxalic acid;piperidin-1-yl-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methanone.
| Compound Name | oxalic acid;piperidin-1-yl-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 2932263 |
| Molecular Formula | C21H27F3N2O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | oxalic acid;piperidin-1-yl-[1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(Cc2ccccc2C(F)(F)F)C1)N1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25F3N2O.C2H2O4/c20-19(21,22)17-9-3-2-7-15(17)13-23-10-6-8-16(14-23)18(25)24-11-4-1-5-12-24;3-1(4)2(5)6/h2-3,7,9,16H,1,4-6,8,10-14H2;(H,3,4)(H,5,6) |
| InChIKey | AXKWNQLBGNABRM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|