C18H12F8N2O — CID 2932644
(2,3,4,5,6-pentafluorophenyl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 2932644) has the molecular formula C18H12F8N2O and a molecular weight of 424.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2932644 |
| Molecular Formula | C18H12F8N2O |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H12F8N2O/c19-12-11(13(20)15(22)16(23)14(12)21)17(29)28-6-4-27(5-7-28)10-3-1-2-9(8-10)18(24,25)26/h1-3,8H,4-7H2 |
| InChIKey | JTOKJXBHSKFVCK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|