C18H10F10N2O2 — CID 2933145
2,3,4,5,6-pentafluoro-N-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]butyl]benzamide (PubChem CID 2933145) has the molecular formula C18H10F10N2O2 and a molecular weight of 476.27 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]butyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 2933145 |
| Molecular Formula | C18H10F10N2O2 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[(2,3,4,5,6-pentafluorobenzoyl)amino]butyl]benzamide |
| SMILES | O=C(NCCCCNC(=O)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H10F10N2O2/c19-7-5(8(20)12(24)15(27)11(7)23)17(31)29-3-1-2-4-30-18(32)6-9(21)13(25)16(28)14(26)10(6)22/h1-4H2,(H,29,31)(H,30,32) |
| InChIKey | SPALXISLAWNMGA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|