About 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline
6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline (PubChem CID 2933162) has the molecular formula C16H15F2NO2S
and a molecular weight of 323.36 g/mol. Its IUPAC name is 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 2933162 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1CCc2cc(F)ccc2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15F2NO2S/c1-11-2-3-12-10-14(18)6-9-16(12)19(11)22(20,21)15-7-4-13(17)5-8-15/h4-11H,2-3H2,1H3 |
| InChIKey | VLKRLGDNQLDSQU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline (CID 2933162) is 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline is CC1CCc2cc(F)ccc2N1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is VLKRLGDNQLDSQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO2S/c1-11-2-3-12-10-14(18)6-9-16(12)19(11)22(20,21)15-7-4-13(17)5-8-15/h4-11H,2-3H2,1H3.
What are the key properties of 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline?
6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 323.36 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-(4-fluorophenyl)sulfonyl-2-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 2933162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).