About methyl 4,4-dinitrobutanoate
methyl 4,4-dinitrobutanoate (PubChem CID 29332) has the molecular formula C5H8N2O6
and a molecular weight of 192.13 g/mol. Its IUPAC name is methyl 4,4-dinitrobutanoate.
Molecular Properties
| Compound Name | methyl 4,4-dinitrobutanoate |
| PubChem CID | 29332 |
| Molecular Formula | C5H8N2O6 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | methyl 4,4-dinitrobutanoate |
| SMILES | COC(=O)CCC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N2O6/c1-13-5(8)3-2-4(6(9)10)7(11)12/h4H,2-3H2,1H3 |
| InChIKey | OGBDJCLSUZCLLV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4,4-dinitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,4-dinitrobutanoate?
The IUPAC name of methyl 4,4-dinitrobutanoate (CID 29332) is methyl 4,4-dinitrobutanoate.
What is the SMILES notation for methyl 4,4-dinitrobutanoate?
The canonical SMILES for methyl 4,4-dinitrobutanoate is COC(=O)CCC([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of methyl 4,4-dinitrobutanoate?
The InChIKey is OGBDJCLSUZCLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O6/c1-13-5(8)3-2-4(6(9)10)7(11)12/h4H,2-3H2,1H3.
What are the key properties of methyl 4,4-dinitrobutanoate?
methyl 4,4-dinitrobutanoate has a molecular weight of 192.13 g/mol, XLogP of -0.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,4-dinitrobutanoate is sourced from PubChem (CID 29332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).