About 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one
1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (PubChem CID 2933284) has the molecular formula C19H14FNO
and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| PubChem CID | 2933284 |
| Molecular Formula | C19H14FNO |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1CC(c2ccc(F)cc2)c2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C19H14FNO/c20-14-8-5-13(6-9-14)16-11-18(22)21-17-10-7-12-3-1-2-4-15(12)19(16)17/h1-10,16H,11H2,(H,21,22) |
| InChIKey | JNIGWNURQSBNOR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one?
The IUPAC name of 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (CID 2933284) is 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
What is the SMILES notation for 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one?
The canonical SMILES for 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one is O=C1CC(c2ccc(F)cc2)c2c(ccc3ccccc23)N1.
What is the InChIKey of 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one?
The InChIKey is JNIGWNURQSBNOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FNO/c20-14-8-5-13(6-9-14)16-11-18(22)21-17-10-7-12-3-1-2-4-15(12)19(16)17/h1-10,16H,11H2,(H,21,22).
What are the key properties of 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one?
1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one has a molecular weight of 291.33 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one is sourced from PubChem (CID 2933284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).